C29H33F6NO2S — CID 129299619
1-[[4-[2-(1-butyl-2-methylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]methoxy]-2,2-dimethylpropan-1-ol (PubChem CID 129299619) has the molecular formula C29H33F6NO2S and a molecular weight of 573.64 g/mol. Its IUPAC name is 1-[[4-[2-(1-butyl-2-methylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]methoxy]-2,2-dimethylpropan-1-ol.
| Compound Name | 1-[[4-[2-(1-butyl-2-methylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]methoxy]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 129299619 |
| Molecular Formula | C29H33F6NO2S |
| Molecular Weight | 573.64 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | 1-[[4-[2-(1-butyl-2-methylindol-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]methoxy]-2,2-dimethylpropan-1-ol |
| SMILES | CCCCn1c(C)c(C2=C(c3cc(COC(O)C(C)(C)C)sc3C)C(F)(F)C(F)(F)C2(F)F)c2ccccc21 |
| InChI | InChI=1S/C29H33F6NO2S/c1-7-8-13-36-16(2)22(19-11-9-10-12-21(19)36)24-23(27(30,31)29(34,35)28(24,32)33)20-14-18(39-17(20)3)15-38-25(37)26(4,5)6/h9-12,14,25,37H,7-8,13,15H2,1-6H3 |
| InChIKey | VGJOIGIWWBXIQA-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.64 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|