C26H19F6N — CID 102583040
3-[3,3,4,4,5,5-hexafluoro-2-(2-methylnaphthalen-1-yl)cyclopenten-1-yl]-1,2-dimethylindole (PubChem CID 102583040) has the molecular formula C26H19F6N and a molecular weight of 459.43 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(2-methylnaphthalen-1-yl)cyclopenten-1-yl]-1,2-dimethylindole.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-methylnaphthalen-1-yl)cyclopenten-1-yl]-1,2-dimethylindole |
|---|---|
| PubChem CID | 102583040 |
| Molecular Formula | C26H19F6N |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-methylnaphthalen-1-yl)cyclopenten-1-yl]-1,2-dimethylindole |
| SMILES | Cc1ccc2ccccc2c1C1=C(c2c(C)n(C)c3ccccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C26H19F6N/c1-14-12-13-16-8-4-5-9-17(16)20(14)22-23(25(29,30)26(31,32)24(22,27)28)21-15(2)33(3)19-11-7-6-10-18(19)21/h4-13H,1-3H3 |
| InChIKey | RBTXWRIUANALBI-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|