C32H27F6NOS2 — CID 144561510
(Z)-1-[4-[4-[[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]methyl]-5-methylthiophen-2-yl]phenoxy]but-2-en-2-amine (PubChem CID 144561510) has the molecular formula C32H27F6NOS2 and a molecular weight of 619.70 g/mol. Its IUPAC name is (Z)-1-[4-[4-[[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]methyl]-5-methylthiophen-2-yl]phenoxy]but-2-en-2-amine.
| Compound Name | (Z)-1-[4-[4-[[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]methyl]-5-methylthiophen-2-yl]phenoxy]but-2-en-2-amine |
|---|---|
| PubChem CID | 144561510 |
| Molecular Formula | C32H27F6NOS2 |
| Molecular Weight | 619.70 g/mol |
| Exact Mass | 619.14 |
| IUPAC Name | (Z)-1-[4-[4-[[3,3,4,4,5,5-hexafluoro-2-(2-methyl-5-phenylthiophen-3-yl)cyclopenten-1-yl]methyl]-5-methylthiophen-2-yl]phenoxy]but-2-en-2-amine |
| SMILES | C/C=C(\N)COc1ccc(-c2cc(CC3=C(c4cc(-c5ccccc5)sc4C)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1 |
| InChI | InChI=1S/C32H27F6NOS2/c1-4-23(39)17-40-24-12-10-21(11-13-24)27-15-22(18(2)41-27)14-26-29(31(35,36)32(37,38)30(26,33)34)25-16-28(42-19(25)3)20-8-6-5-7-9-20/h4-13,15-16H,14,17,39H2,1-3H3/b23-4- |
| InChIKey | VLCBWVIGJAJVKE-WVHIBCRRSA-N |
| XLogP | 9.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.70 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|