C34H33F6NO2S2 — CID 157115961
3-[4-[4-[2-[5-(4-butoxyphenyl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]phenoxy]propan-1-amine (PubChem CID 157115961) has the molecular formula C34H33F6NO2S2 and a molecular weight of 665.76 g/mol. Its IUPAC name is 3-[4-[4-[2-[5-(4-butoxyphenyl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]phenoxy]propan-1-amine.
| Compound Name | 3-[4-[4-[2-[5-(4-butoxyphenyl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]phenoxy]propan-1-amine |
|---|---|
| PubChem CID | 157115961 |
| Molecular Formula | C34H33F6NO2S2 |
| Molecular Weight | 665.76 g/mol |
| Exact Mass | 665.19 |
| IUPAC Name | 3-[4-[4-[2-[5-(4-butoxyphenyl)-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]phenoxy]propan-1-amine |
| SMILES | CCCCOc1ccc(-c2cc(C3=C(c4cc(-c5ccc(OCCCN)cc5)sc4C)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1 |
| InChI | InChI=1S/C34H33F6NO2S2/c1-4-5-16-42-24-11-7-22(8-12-24)28-18-26(20(2)44-28)30-31(33(37,38)34(39,40)32(30,35)36)27-19-29(45-21(27)3)23-9-13-25(14-10-23)43-17-6-15-41/h7-14,18-19H,4-6,15-17,41H2,1-3H3 |
| InChIKey | PGWIJOQTBGJSSX-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.76 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|