C30H26F6N2S2 — CID 151297106
[4-[4-[2-[5-[4-(aminomethyl)phenyl]-2,4-dimethylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]methanamine (PubChem CID 151297106) has the molecular formula C30H26F6N2S2 and a molecular weight of 592.67 g/mol. Its IUPAC name is [4-[4-[2-[5-[4-(aminomethyl)phenyl]-2,4-dimethylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]methanamine.
| Compound Name | [4-[4-[2-[5-[4-(aminomethyl)phenyl]-2,4-dimethylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 151297106 |
| Molecular Formula | C30H26F6N2S2 |
| Molecular Weight | 592.67 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | [4-[4-[2-[5-[4-(aminomethyl)phenyl]-2,4-dimethylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]phenyl]methanamine |
| SMILES | Cc1sc(-c2ccc(CN)cc2)cc1C1=C(c2c(C)sc(-c3ccc(CN)cc3)c2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C30H26F6N2S2/c1-15-24(17(3)40-27(15)21-10-6-19(14-38)7-11-21)26-25(28(31,32)30(35,36)29(26,33)34)22-12-23(39-16(22)2)20-8-4-18(13-37)5-9-20/h4-12H,13-14,37-38H2,1-3H3 |
| InChIKey | OBQGZSYCPMXNTN-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.67 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|