C31H26BF6NS2 — CID 174092951
CID 174092951 (PubChem CID 174092951) has the molecular formula C31H26BF6NS2 and a molecular weight of 601.49 g/mol.
| Compound Name | CID 174092951 |
|---|---|
| PubChem CID | 174092951 |
| Molecular Formula | C31H26BF6NS2 |
| Molecular Weight | 601.49 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | — |
| SMILES | [B]CCCCc1ccc(-c2cc(C3=C(c4csc(-c5ccc(CN)cc5)c4)C(F)(F)C(F)(F)C3(F)F)c(C)s2)cc1 |
| InChI | InChI=1S/C31H26BF6NS2/c1-18-24(15-26(41-18)22-9-5-19(6-10-22)4-2-3-13-32)28-27(29(33,34)31(37,38)30(28,35)36)23-14-25(40-17-23)21-11-7-20(16-39)8-12-21/h5-12,14-15,17H,2-4,13,16,39H2,1H3 |
| InChIKey | DCRKCUDWXGJFSY-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.49 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|