C30H32BNS2 — CID 174092874
CID 174092874 (PubChem CID 174092874) has the molecular formula C30H32BNS2 and a molecular weight of 481.54 g/mol.
| Compound Name | CID 174092874 |
|---|---|
| PubChem CID | 174092874 |
| Molecular Formula | C30H32BNS2 |
| Molecular Weight | 481.54 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | — |
| SMILES | [B]CCCCc1ccc(-c2cc(/C(C)=C(/C)c3csc(-c4ccc(CN)cc4)c3)c(C)s2)cc1 |
| InChI | InChI=1S/C30H32BNS2/c1-20(27-16-29(33-19-27)25-13-9-24(18-32)10-14-25)21(2)28-17-30(34-22(28)3)26-11-7-23(8-12-26)6-4-5-15-31/h7-14,16-17,19H,4-6,15,18,32H2,1-3H3/b21-20- |
| InChIKey | XNGXKVUVIRZLEM-MRCUWXFGSA-N |
| XLogP | 8.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.54 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|