C20H12F6O2S — CID 102455433
4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde (PubChem CID 102455433) has the molecular formula C20H12F6O2S and a molecular weight of 430.37 g/mol. Its IUPAC name is 4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde.
| Compound Name | 4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 102455433 |
| Molecular Formula | C20H12F6O2S |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 4-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzofuran-3-yl)cyclopenten-1-yl]-5-methylthiophene-2-carbaldehyde |
| SMILES | Cc1oc2ccccc2c1C1=C(c2cc(C=O)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C20H12F6O2S/c1-9-15(12-5-3-4-6-14(12)28-9)17-16(13-7-11(8-27)29-10(13)2)18(21,22)20(25,26)19(17,23)24/h3-8H,1-2H3 |
| InChIKey | YWQLFJKVUJPLER-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|