C30H23F6N3OS3 — CID 177391905
1-[(E)-[5-[4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-2-hydroxyphenyl]methylideneamino]-3-phenylthiourea (PubChem CID 177391905) has the molecular formula C30H23F6N3OS3 and a molecular weight of 651.72 g/mol. Its IUPAC name is 1-[(E)-[5-[4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-2-hydroxyphenyl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-[5-[4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-2-hydroxyphenyl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 177391905 |
| Molecular Formula | C30H23F6N3OS3 |
| Molecular Weight | 651.72 g/mol |
| Exact Mass | 651.09 |
| IUPAC Name | 1-[(E)-[5-[4-[2-(2,5-dimethylthiophen-3-yl)-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-2-hydroxyphenyl]methylideneamino]-3-phenylthiourea |
| SMILES | Cc1cc(C2=C(c3cc(-c4ccc(O)c(/C=N/NC(=S)Nc5ccccc5)c4)sc3C)C(F)(F)C(F)(F)C2(F)F)c(C)s1 |
| InChI | InChI=1S/C30H23F6N3OS3/c1-15-11-21(16(2)42-15)25-26(29(33,34)30(35,36)28(25,31)32)22-13-24(43-17(22)3)18-9-10-23(40)19(12-18)14-37-39-27(41)38-20-7-5-4-6-8-20/h4-14,40H,1-3H3,(H2,38,39,41)/b37-14+ |
| InChIKey | TUWIHHHIRYPYQT-JAVCYFNSSA-N |
| XLogP | 9.26 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.72 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|