C34H35N5O7 — CID 2833847
3-N-[2-(1,3-benzodioxol-5-ylmethylideneamino)phenyl]-4,6-dinitro-1-N-(4-octoxyphenyl)benzene-1,3-diamine (PubChem CID 2833847) has the molecular formula C34H35N5O7 and a molecular weight of 625.68 g/mol. Its IUPAC name is 3-N-[2-(1,3-benzodioxol-5-ylmethylideneamino)phenyl]-4,6-dinitro-1-N-(4-octoxyphenyl)benzene-1,3-diamine.
| Compound Name | 3-N-[2-(1,3-benzodioxol-5-ylmethylideneamino)phenyl]-4,6-dinitro-1-N-(4-octoxyphenyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 2833847 |
| Molecular Formula | C34H35N5O7 |
| Molecular Weight | 625.68 g/mol |
| Exact Mass | 625.25 |
| IUPAC Name | 3-N-[2-(1,3-benzodioxol-5-ylmethylideneamino)phenyl]-4,6-dinitro-1-N-(4-octoxyphenyl)benzene-1,3-diamine |
| SMILES | CCCCCCCCOc1ccc(Nc2cc(Nc3ccccc3/N=C/c3ccc4c(c3)OCO4)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H35N5O7/c1-2-3-4-5-6-9-18-44-26-15-13-25(14-16-26)36-29-20-30(32(39(42)43)21-31(29)38(40)41)37-28-11-8-7-10-27(28)35-22-24-12-17-33-34(19-24)46-23-45-33/h7-8,10-17,19-22,36-37H,2-6,9,18,23H2,1H3/b35-22+ |
| InChIKey | CVSZOUVEUUNIGE-FADJLKOXSA-N |
| XLogP | 9.21 |
| TPSA | 150.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.68 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|