C26H21N5O5 — CID 3398102
2-[[2-[5-(4-methylanilino)-2,4-dinitroanilino]phenyl]iminomethyl]phenol (PubChem CID 3398102) has the molecular formula C26H21N5O5 and a molecular weight of 483.48 g/mol. Its IUPAC name is 2-[[2-[5-(4-methylanilino)-2,4-dinitroanilino]phenyl]iminomethyl]phenol.
| Compound Name | 2-[[2-[5-(4-methylanilino)-2,4-dinitroanilino]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 3398102 |
| Molecular Formula | C26H21N5O5 |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 2-[[2-[5-(4-methylanilino)-2,4-dinitroanilino]phenyl]iminomethyl]phenol |
| SMILES | Cc1ccc(Nc2cc(Nc3ccccc3/N=C\c3ccccc3O)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H21N5O5/c1-17-10-12-19(13-11-17)28-22-14-23(25(31(35)36)15-24(22)30(33)34)29-21-8-4-3-7-20(21)27-16-18-6-2-5-9-26(18)32/h2-16,28-29,32H,1H3/b27-16- |
| InChIKey | PRCAIHQUADUJPG-YUMHPJSZSA-N |
| XLogP | 6.75 |
| TPSA | 142.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|