C24H20N6O4 — CID 71504070
3-N-[2-(4-methylanilino)phenyl]-4,6-dinitro-1-N-pyridin-3-ylbenzene-1,3-diamine (PubChem CID 71504070) has the molecular formula C24H20N6O4 and a molecular weight of 456.46 g/mol. Its IUPAC name is 3-N-[2-(4-methylanilino)phenyl]-4,6-dinitro-1-N-pyridin-3-ylbenzene-1,3-diamine.
| Compound Name | 3-N-[2-(4-methylanilino)phenyl]-4,6-dinitro-1-N-pyridin-3-ylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 71504070 |
| Molecular Formula | C24H20N6O4 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3-N-[2-(4-methylanilino)phenyl]-4,6-dinitro-1-N-pyridin-3-ylbenzene-1,3-diamine |
| SMILES | Cc1ccc(Nc2ccccc2Nc2cc(Nc3cccnc3)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H20N6O4/c1-16-8-10-17(11-9-16)26-19-6-2-3-7-20(19)28-22-13-21(27-18-5-4-12-25-15-18)23(29(31)32)14-24(22)30(33)34/h2-15,26-28H,1H3 |
| InChIKey | YZNDOJJLOHGEGT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 135.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|