C23H21ClN6 — CID 71505179
2-N-[2-(4-chloroanilino)phenyl]-4-N-pyridin-3-ylbenzene-1,2,4,5-tetramine (PubChem CID 71505179) has the molecular formula C23H21ClN6 and a molecular weight of 416.92 g/mol. Its IUPAC name is 2-N-[2-(4-chloroanilino)phenyl]-4-N-pyridin-3-ylbenzene-1,2,4,5-tetramine.
| Compound Name | 2-N-[2-(4-chloroanilino)phenyl]-4-N-pyridin-3-ylbenzene-1,2,4,5-tetramine |
|---|---|
| PubChem CID | 71505179 |
| Molecular Formula | C23H21ClN6 |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 2-N-[2-(4-chloroanilino)phenyl]-4-N-pyridin-3-ylbenzene-1,2,4,5-tetramine |
| SMILES | Nc1cc(N)c(Nc2ccccc2Nc2ccc(Cl)cc2)cc1Nc1cccnc1 |
| InChI | InChI=1S/C23H21ClN6/c24-15-7-9-16(10-8-15)28-20-5-1-2-6-21(20)30-23-13-22(18(25)12-19(23)26)29-17-4-3-11-27-14-17/h1-14,28-30H,25-26H2 |
| InChIKey | JYEUFLJQYNSQNN-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 101.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|