C11H14N2O4 — CID 116987853
N-[(7-nitro-1,3-benzodioxol-5-yl)methyl]propan-2-amine (PubChem CID 116987853) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is N-[(7-nitro-1,3-benzodioxol-5-yl)methyl]propan-2-amine.
| Compound Name | N-[(7-nitro-1,3-benzodioxol-5-yl)methyl]propan-2-amine |
|---|---|
| PubChem CID | 116987853 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | N-[(7-nitro-1,3-benzodioxol-5-yl)methyl]propan-2-amine |
| SMILES | CC(C)NCc1cc2c(c([N+](=O)[O-])c1)OCO2 |
| InChI | InChI=1S/C11H14N2O4/c1-7(2)12-5-8-3-9(13(14)15)11-10(4-8)16-6-17-11/h3-4,7,12H,5-6H2,1-2H3 |
| InChIKey | JMJNHNYKWXDYKY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|