C8H6N2O5 — CID 116987947
7-nitro-1,3-benzodioxole-5-carboxamide (PubChem CID 116987947) has the molecular formula C8H6N2O5 and a molecular weight of 210.15 g/mol. Its IUPAC name is 7-nitro-1,3-benzodioxole-5-carboxamide.
| Compound Name | 7-nitro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 116987947 |
| Molecular Formula | C8H6N2O5 |
| Molecular Weight | 210.15 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 7-nitro-1,3-benzodioxole-5-carboxamide |
| SMILES | NC(=O)c1cc2c(c([N+](=O)[O-])c1)OCO2 |
| InChI | InChI=1S/C8H6N2O5/c9-8(11)4-1-5(10(12)13)7-6(2-4)14-3-15-7/h1-2H,3H2,(H2,9,11) |
| InChIKey | KSUFCFJGDZGDBY-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.15 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|