C14H13NO6 — CID 87843817
(E,4E)-4-[(7-nitro-1,3-benzodioxol-5-yl)methylidene]hex-2-enoic acid (PubChem CID 87843817) has the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. Its IUPAC name is (E,4E)-4-[(7-nitro-1,3-benzodioxol-5-yl)methylidene]hex-2-enoic acid.
| Compound Name | (E,4E)-4-[(7-nitro-1,3-benzodioxol-5-yl)methylidene]hex-2-enoic acid |
|---|---|
| PubChem CID | 87843817 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | (E,4E)-4-[(7-nitro-1,3-benzodioxol-5-yl)methylidene]hex-2-enoic acid |
| SMILES | CCC(/C=C/C(=O)O)=C\c1cc2c(c([N+](=O)[O-])c1)OCO2 |
| InChI | InChI=1S/C14H13NO6/c1-2-9(3-4-13(16)17)5-10-6-11(15(18)19)14-12(7-10)20-8-21-14/h3-7H,2,8H2,1H3,(H,16,17)/b4-3+,9-5+ |
| InChIKey | CUZRCSKKLPZXJF-PRKJJMSOSA-N |
| XLogP | 2.76 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|