C11H10ClNO4 — CID 55016969
4-chloro-6-[(E)-2-nitrobut-1-enyl]-1,3-benzodioxole (PubChem CID 55016969) has the molecular formula C11H10ClNO4 and a molecular weight of 255.66 g/mol. Its IUPAC name is 4-chloro-6-[(E)-2-nitrobut-1-enyl]-1,3-benzodioxole.
| Compound Name | 4-chloro-6-[(E)-2-nitrobut-1-enyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 55016969 |
| Molecular Formula | C11H10ClNO4 |
| Molecular Weight | 255.66 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4-chloro-6-[(E)-2-nitrobut-1-enyl]-1,3-benzodioxole |
| SMILES | CC/C(=C\c1cc(Cl)c2c(c1)OCO2)[N+](=O)[O-] |
| InChI | InChI=1S/C11H10ClNO4/c1-2-8(13(14)15)3-7-4-9(12)11-10(5-7)16-6-17-11/h3-5H,2,6H2,1H3/b8-3+ |
| InChIKey | CUAHXAKQZYOWOJ-FPYGCLRLSA-N |
| XLogP | 3.10 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.66 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|