C17H13ClN2O6 — CID 9040053
ethyl 2-[(E)-2-(7-chloro-1,3-benzodioxol-5-yl)ethenyl]-5-nitropyridine-3-carboxylate (PubChem CID 9040053) has the molecular formula C17H13ClN2O6 and a molecular weight of 376.75 g/mol. Its IUPAC name is ethyl 2-[(E)-2-(7-chloro-1,3-benzodioxol-5-yl)ethenyl]-5-nitropyridine-3-carboxylate.
| Compound Name | ethyl 2-[(E)-2-(7-chloro-1,3-benzodioxol-5-yl)ethenyl]-5-nitropyridine-3-carboxylate |
|---|---|
| PubChem CID | 9040053 |
| Molecular Formula | C17H13ClN2O6 |
| Molecular Weight | 376.75 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | ethyl 2-[(E)-2-(7-chloro-1,3-benzodioxol-5-yl)ethenyl]-5-nitropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])cnc1/C=C/c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C17H13ClN2O6/c1-2-24-17(21)12-7-11(20(22)23)8-19-14(12)4-3-10-5-13(18)16-15(6-10)25-9-26-16/h3-8H,2,9H2,1H3/b4-3+ |
| InChIKey | IRGDMPGNHKTCCE-ONEGZZNKSA-N |
| XLogP | 3.72 |
| TPSA | 100.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.75 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|