C19H22N4O6S — CID 51565176
ethyl 2-[(E)-2-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]ethenyl]-5-nitropyridine-3-carboxylate (PubChem CID 51565176) has the molecular formula C19H22N4O6S and a molecular weight of 434.47 g/mol. Its IUPAC name is ethyl 2-[(E)-2-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]ethenyl]-5-nitropyridine-3-carboxylate.
| Compound Name | ethyl 2-[(E)-2-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]ethenyl]-5-nitropyridine-3-carboxylate |
|---|---|
| PubChem CID | 51565176 |
| Molecular Formula | C19H22N4O6S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | ethyl 2-[(E)-2-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]ethenyl]-5-nitropyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])cnc1/C=C/c1c(C)nn([C@@H]2CCS(=O)(=O)C2)c1C |
| InChI | InChI=1S/C19H22N4O6S/c1-4-29-19(24)17-9-15(23(25)26)10-20-18(17)6-5-16-12(2)21-22(13(16)3)14-7-8-30(27,28)11-14/h5-6,9-10,14H,4,7-8,11H2,1-3H3/b6-5+/t14-/m1/s1 |
| InChIKey | RFRQCBSQRGGNAS-VBROQKIQSA-N |
| XLogP | 2.51 |
| TPSA | 134.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|