C20H19ClN2O3 — CID 9341456
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-(2,5-dimethyl-1-propylpyrrole-3-carbonyl)prop-2-enenitrile (PubChem CID 9341456) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-(2,5-dimethyl-1-propylpyrrole-3-carbonyl)prop-2-enenitrile.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-(2,5-dimethyl-1-propylpyrrole-3-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9341456 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-2-(2,5-dimethyl-1-propylpyrrole-3-carbonyl)prop-2-enenitrile |
| SMILES | CCCn1c(C)cc(C(=O)/C(C#N)=C/c2cc(Cl)c3c(c2)OCO3)c1C |
| InChI | InChI=1S/C20H19ClN2O3/c1-4-5-23-12(2)6-16(13(23)3)19(24)15(10-22)7-14-8-17(21)20-18(9-14)25-11-26-20/h6-9H,4-5,11H2,1-3H3/b15-7+ |
| InChIKey | BZZCTQYJTOMXAT-VIZOYTHASA-N |
| XLogP | 4.69 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|