C19H19N3O3 — CID 92929966
(Z)-2-(2,5-dimethyl-1-propylpyrrole-3-carbonyl)-3-(2-nitrophenyl)prop-2-enenitrile (PubChem CID 92929966) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is (Z)-2-(2,5-dimethyl-1-propylpyrrole-3-carbonyl)-3-(2-nitrophenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(2,5-dimethyl-1-propylpyrrole-3-carbonyl)-3-(2-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 92929966 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (Z)-2-(2,5-dimethyl-1-propylpyrrole-3-carbonyl)-3-(2-nitrophenyl)prop-2-enenitrile |
| SMILES | CCCn1c(C)cc(C(=O)/C(C#N)=C\c2ccccc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C19H19N3O3/c1-4-9-21-13(2)10-17(14(21)3)19(23)16(12-20)11-15-7-5-6-8-18(15)22(24)25/h5-8,10-11H,4,9H2,1-3H3/b16-11- |
| InChIKey | CKKOJPONFNNLCC-WJDWOHSUSA-N |
| XLogP | 4.21 |
| TPSA | 88.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|