C21H21N3O2 — CID 75535282
N-[4-[(Z)-2-cyano-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-oxoprop-1-enyl]phenyl]acetamide (PubChem CID 75535282) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[4-[(Z)-2-cyano-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-oxoprop-1-enyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-2-cyano-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-oxoprop-1-enyl]phenyl]acetamide |
|---|---|
| PubChem CID | 75535282 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N-[4-[(Z)-2-cyano-3-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-3-oxoprop-1-enyl]phenyl]acetamide |
| SMILES | C=CCn1c(C)cc(C(=O)/C(C#N)=C\c2ccc(NC(C)=O)cc2)c1C |
| InChI | InChI=1S/C21H21N3O2/c1-5-10-24-14(2)11-20(15(24)3)21(26)18(13-22)12-17-6-8-19(9-7-17)23-16(4)25/h5-9,11-12H,1,10H2,2-4H3,(H,23,25)/b18-12- |
| InChIKey | MVCGYCKZXKUYSD-PDGQHHTCSA-N |
| XLogP | 4.04 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|