C20H22N6O2S — CID 46572727
N-[3-[5-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]sulfanyltetrazol-1-yl]phenyl]acetamide (PubChem CID 46572727) has the molecular formula C20H22N6O2S and a molecular weight of 410.50 g/mol. Its IUPAC name is N-[3-[5-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]sulfanyltetrazol-1-yl]phenyl]acetamide.
| Compound Name | N-[3-[5-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]sulfanyltetrazol-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 46572727 |
| Molecular Formula | C20H22N6O2S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[3-[5-[2-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-oxoethyl]sulfanyltetrazol-1-yl]phenyl]acetamide |
| SMILES | C=CCn1c(C)cc(C(=O)CSc2nnnn2-c2cccc(NC(C)=O)c2)c1C |
| InChI | InChI=1S/C20H22N6O2S/c1-5-9-25-13(2)10-18(14(25)3)19(28)12-29-20-22-23-24-26(20)17-8-6-7-16(11-17)21-15(4)27/h5-8,10-11H,1,9,12H2,2-4H3,(H,21,27) |
| InChIKey | CYJIZCKJVBPFDR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|