C20H22N6O2S2 — CID 46572572
2-[1-(3-acetamidophenyl)tetrazol-5-yl]sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide (PubChem CID 46572572) has the molecular formula C20H22N6O2S2 and a molecular weight of 442.57 g/mol. Its IUPAC name is 2-[1-(3-acetamidophenyl)tetrazol-5-yl]sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide.
| Compound Name | 2-[1-(3-acetamidophenyl)tetrazol-5-yl]sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
|---|---|
| PubChem CID | 46572572 |
| Molecular Formula | C20H22N6O2S2 |
| Molecular Weight | 442.57 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-[1-(3-acetamidophenyl)tetrazol-5-yl]sulfanyl-N-[2-(4-methylphenyl)sulfanylethyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-n2nnnc2SCC(=O)NCCSc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C20H22N6O2S2/c1-14-6-8-18(9-7-14)29-11-10-21-19(28)13-30-20-23-24-25-26(20)17-5-3-4-16(12-17)22-15(2)27/h3-9,12H,10-11,13H2,1-2H3,(H,21,28)(H,22,27) |
| InChIKey | MNKFNMXMZYUAKM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|