C21H24N6O2S — CID 55571388
2-[1-(3-acetamidophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-6-propan-2-ylphenyl)acetamide (PubChem CID 55571388) has the molecular formula C21H24N6O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is 2-[1-(3-acetamidophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-6-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[1-(3-acetamidophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 55571388 |
| Molecular Formula | C21H24N6O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[1-(3-acetamidophenyl)tetrazol-5-yl]sulfanyl-N-(2-methyl-6-propan-2-ylphenyl)acetamide |
| SMILES | CC(=O)Nc1cccc(-n2nnnc2SCC(=O)Nc2c(C)cccc2C(C)C)c1 |
| InChI | InChI=1S/C21H24N6O2S/c1-13(2)18-10-5-7-14(3)20(18)23-19(29)12-30-21-24-25-26-27(21)17-9-6-8-16(11-17)22-15(4)28/h5-11,13H,12H2,1-4H3,(H,22,28)(H,23,29) |
| InChIKey | DDQNBVAOKALGIU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |