C30H31N3O5 — CID 6006748
dimethyl 5-[3-[(E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 6006748) has the molecular formula C30H31N3O5 and a molecular weight of 513.59 g/mol. Its IUPAC name is dimethyl 5-[3-[(E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-[(E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 6006748 |
| Molecular Formula | C30H31N3O5 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | dimethyl 5-[3-[(E)-2-cyano-3-[4-(diethylamino)phenyl]prop-2-enoyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | CCN(CC)c1ccc(/C=C(\C#N)C(=O)c2cc(C)n(-c3cc(C(=O)OC)cc(C(=O)OC)c3)c2C)cc1 |
| InChI | InChI=1S/C30H31N3O5/c1-7-32(8-2)25-11-9-21(10-12-25)14-24(18-31)28(34)27-13-19(3)33(20(27)4)26-16-22(29(35)37-5)15-23(17-26)30(36)38-6/h9-17H,7-8H2,1-6H3/b24-14+ |
| InChIKey | AEUWMIXQJUIVPA-ZVHZXABRSA-N |
| XLogP | 5.30 |
| TPSA | 101.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|