C23H29N2O5+ — CID 9249474
dimethyl 5-[2,5-dimethyl-3-(2-piperidin-1-ium-1-ylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 9249474) has the molecular formula C23H29N2O5+ and a molecular weight of 413.49 g/mol. Its IUPAC name is dimethyl 5-[2,5-dimethyl-3-(2-piperidin-1-ium-1-ylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2,5-dimethyl-3-(2-piperidin-1-ium-1-ylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 9249474 |
| Molecular Formula | C23H29N2O5+ |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | dimethyl 5-[2,5-dimethyl-3-(2-piperidin-1-ium-1-ylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-n2c(C)cc(C(=O)C[NH+]3CCCCC3)c2C)c1 |
| InChI | InChI=1S/C23H28N2O5/c1-15-10-20(21(26)14-24-8-6-5-7-9-24)16(2)25(15)19-12-17(22(27)29-3)11-18(13-19)23(28)30-4/h10-13H,5-9,14H2,1-4H3/p+1 |
| InChIKey | XCAZFDZYRZJIDU-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|