C23H22N2O5S — CID 18291646
dimethyl 5-[2,5-dimethyl-3-(2-pyridin-2-ylsulfanylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 18291646) has the molecular formula C23H22N2O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is dimethyl 5-[2,5-dimethyl-3-(2-pyridin-2-ylsulfanylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2,5-dimethyl-3-(2-pyridin-2-ylsulfanylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 18291646 |
| Molecular Formula | C23H22N2O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | dimethyl 5-[2,5-dimethyl-3-(2-pyridin-2-ylsulfanylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-n2c(C)cc(C(=O)CSc3ccccn3)c2C)c1 |
| InChI | InChI=1S/C23H22N2O5S/c1-14-9-19(20(26)13-31-21-7-5-6-8-24-21)15(2)25(14)18-11-16(22(27)29-3)10-17(12-18)23(28)30-4/h5-12H,13H2,1-4H3 |
| InChIKey | QIKPTQLRFTXLGU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|