C22H19Cl2N3O6 — CID 16531577
dimethyl 5-[3-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 16531577) has the molecular formula C22H19Cl2N3O6 and a molecular weight of 492.32 g/mol. Its IUPAC name is dimethyl 5-[3-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 16531577 |
| Molecular Formula | C22H19Cl2N3O6 |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | dimethyl 5-[3-[2-(4,5-dichloro-6-oxopyridazin-1-yl)acetyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-n2c(C)cc(C(=O)Cn3ncc(Cl)c(Cl)c3=O)c2C)c1 |
| InChI | InChI=1S/C22H19Cl2N3O6/c1-11-5-16(18(28)10-26-20(29)19(24)17(23)9-25-26)12(2)27(11)15-7-13(21(30)32-3)6-14(8-15)22(31)33-4/h5-9H,10H2,1-4H3 |
| InChIKey | KRDFGPVSWJOBJC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 109.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|