C22H21N3O5S — CID 18079245
dimethyl 5-[2,5-dimethyl-3-(2-pyrimidin-2-ylsulfanylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 18079245) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is dimethyl 5-[2,5-dimethyl-3-(2-pyrimidin-2-ylsulfanylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2,5-dimethyl-3-(2-pyrimidin-2-ylsulfanylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 18079245 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | dimethyl 5-[2,5-dimethyl-3-(2-pyrimidin-2-ylsulfanylacetyl)pyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-n2c(C)cc(C(=O)CSc3ncccn3)c2C)c1 |
| InChI | InChI=1S/C22H21N3O5S/c1-13-8-18(19(26)12-31-22-23-6-5-7-24-22)14(2)25(13)17-10-15(20(27)29-3)9-16(11-17)21(28)30-4/h5-11H,12H2,1-4H3 |
| InChIKey | CGBYOAOEPUFZOQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 100.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|