C21H23N3O3S — CID 25416181
methyl 4-[3-[2-(1-ethylimidazol-2-yl)sulfanylacetyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 25416181) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is methyl 4-[3-[2-(1-ethylimidazol-2-yl)sulfanylacetyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[3-[2-(1-ethylimidazol-2-yl)sulfanylacetyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 25416181 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | methyl 4-[3-[2-(1-ethylimidazol-2-yl)sulfanylacetyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | CCn1ccnc1SCC(=O)c1cc(C)n(-c2ccc(C(=O)OC)cc2)c1C |
| InChI | InChI=1S/C21H23N3O3S/c1-5-23-11-10-22-21(23)28-13-19(25)18-12-14(2)24(15(18)3)17-8-6-16(7-9-17)20(26)27-4/h6-12H,5,13H2,1-4H3 |
| InChIKey | YVYYDHFLQRIIAB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|