C25H24N4O4S — CID 4815483
methyl 4-[3-[2-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2,5-dimethylpyrrol-1-yl]benzoate (PubChem CID 4815483) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is methyl 4-[3-[2-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2,5-dimethylpyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[3-[2-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2,5-dimethylpyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 4815483 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | methyl 4-[3-[2-[[4-(2-methoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2,5-dimethylpyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(-n2c(C)cc(C(=O)CSc3nncn3-c3ccccc3OC)c2C)cc1 |
| InChI | InChI=1S/C25H24N4O4S/c1-16-13-20(17(2)29(16)19-11-9-18(10-12-19)24(31)33-4)22(30)14-34-25-27-26-15-28(25)21-7-5-6-8-23(21)32-3/h5-13,15H,14H2,1-4H3 |
| InChIKey | GMIIVVTYDJLTKJ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|