C22H25NO7S — CID 30549627
dimethyl 5-[3-[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 30549627) has the molecular formula C22H25NO7S and a molecular weight of 447.51 g/mol. Its IUPAC name is dimethyl 5-[3-[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 30549627 |
| Molecular Formula | C22H25NO7S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | dimethyl 5-[3-[2-(2-ethoxy-2-oxoethyl)sulfanylacetyl]-2,5-dimethylpyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)CSCC(=O)c1cc(C)n(-c2cc(C(=O)OC)cc(C(=O)OC)c2)c1C |
| InChI | InChI=1S/C22H25NO7S/c1-6-30-20(25)12-31-11-19(24)18-7-13(2)23(14(18)3)17-9-15(21(26)28-4)8-16(10-17)22(27)29-5/h7-10H,6,11-12H2,1-5H3 |
| InChIKey | RCDBGFBHGNJDPQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 100.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|