C23H21N3O8 — CID 43030354
dimethyl 5-[2,5-dimethyl-3-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate (PubChem CID 43030354) has the molecular formula C23H21N3O8 and a molecular weight of 467.43 g/mol. Its IUPAC name is dimethyl 5-[2,5-dimethyl-3-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[2,5-dimethyl-3-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 43030354 |
| Molecular Formula | C23H21N3O8 |
| Molecular Weight | 467.43 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | dimethyl 5-[2,5-dimethyl-3-[2-(5-nitro-2-oxo-1-pyridinyl)acetyl]pyrrol-1-yl]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(-n2c(C)cc(C(=O)Cn3cc([N+](=O)[O-])ccc3=O)c2C)c1 |
| InChI | InChI=1S/C23H21N3O8/c1-13-7-19(20(27)12-24-11-17(26(31)32)5-6-21(24)28)14(2)25(13)18-9-15(22(29)33-3)8-16(10-18)23(30)34-4/h5-11H,12H2,1-4H3 |
| InChIKey | SQEZDYZFEVUJFP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 139.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|