C23H20N4O4 — CID 4638113
3-[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]-7-nitroquinazolin-4-one (PubChem CID 4638113) has the molecular formula C23H20N4O4 and a molecular weight of 416.44 g/mol. Its IUPAC name is 3-[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]-7-nitroquinazolin-4-one.
| Compound Name | 3-[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]-7-nitroquinazolin-4-one |
|---|---|
| PubChem CID | 4638113 |
| Molecular Formula | C23H20N4O4 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 3-[2-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-2-oxoethyl]-7-nitroquinazolin-4-one |
| SMILES | Cc1ccc(-n2c(C)cc(C(=O)Cn3cnc4cc([N+](=O)[O-])ccc4c3=O)c2C)cc1 |
| InChI | InChI=1S/C23H20N4O4/c1-14-4-6-17(7-5-14)26-15(2)10-20(16(26)3)22(28)12-25-13-24-21-11-18(27(30)31)8-9-19(21)23(25)29/h4-11,13H,12H2,1-3H3 |
| InChIKey | MFDHNKVKOQUBSV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 100.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|