C22H17BrN4O4 — CID 5038051
3-[2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-7-nitroquinazolin-4-one (PubChem CID 5038051) has the molecular formula C22H17BrN4O4 and a molecular weight of 481.31 g/mol. Its IUPAC name is 3-[2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-7-nitroquinazolin-4-one.
| Compound Name | 3-[2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-7-nitroquinazolin-4-one |
|---|---|
| PubChem CID | 5038051 |
| Molecular Formula | C22H17BrN4O4 |
| Molecular Weight | 481.31 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 3-[2-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-7-nitroquinazolin-4-one |
| SMILES | Cc1cc(C(=O)Cn2cnc3cc([N+](=O)[O-])ccc3c2=O)c(C)n1-c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H17BrN4O4/c1-13-9-19(14(2)26(13)16-5-3-15(23)4-6-16)21(28)11-25-12-24-20-10-17(27(30)31)7-8-18(20)22(25)29/h3-10,12H,11H2,1-2H3 |
| InChIKey | MIVWHRHFONQICJ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 100.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|