C20H16Cl2N4O5 — CID 25379996
1-[2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide (PubChem CID 25379996) has the molecular formula C20H16Cl2N4O5 and a molecular weight of 463.28 g/mol. Its IUPAC name is 1-[2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 25379996 |
| Molecular Formula | C20H16Cl2N4O5 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.05 |
| IUPAC Name | 1-[2-[1-(3,5-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide |
| SMILES | Cc1cc(C(=O)Cn2cc([N+](=O)[O-])cc(C(N)=O)c2=O)c(C)n1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H16Cl2N4O5/c1-10-3-16(11(2)25(10)14-5-12(21)4-13(22)6-14)18(27)9-24-8-15(26(30)31)7-17(19(23)28)20(24)29/h3-8H,9H2,1-2H3,(H2,23,28) |
| InChIKey | FXPGSSVLGARWDE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 130.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|