C17H17ClN4O5 — CID 55546776
1-[2-[1-(4-chlorophenyl)propylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide (PubChem CID 55546776) has the molecular formula C17H17ClN4O5 and a molecular weight of 392.80 g/mol. Its IUPAC name is 1-[2-[1-(4-chlorophenyl)propylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[2-[1-(4-chlorophenyl)propylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 55546776 |
| Molecular Formula | C17H17ClN4O5 |
| Molecular Weight | 392.80 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 1-[2-[1-(4-chlorophenyl)propylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide |
| SMILES | CCC(NC(=O)Cn1cc([N+](=O)[O-])cc(C(N)=O)c1=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClN4O5/c1-2-14(10-3-5-11(18)6-4-10)20-15(23)9-21-8-12(22(26)27)7-13(16(19)24)17(21)25/h3-8,14H,2,9H2,1H3,(H2,19,24)(H,20,23) |
| InChIKey | YLEWBMNXZKMWNI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.80 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|