C15H20N4O5 — CID 42944838
1-[2-[(2-methylcyclohexyl)amino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide (PubChem CID 42944838) has the molecular formula C15H20N4O5 and a molecular weight of 336.35 g/mol. Its IUPAC name is 1-[2-[(2-methylcyclohexyl)amino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[2-[(2-methylcyclohexyl)amino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 42944838 |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | 1-[2-[(2-methylcyclohexyl)amino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide |
| SMILES | CC1CCCCC1NC(=O)Cn1cc([N+](=O)[O-])cc(C(N)=O)c1=O |
| InChI | InChI=1S/C15H20N4O5/c1-9-4-2-3-5-12(9)17-13(20)8-18-7-10(19(23)24)6-11(14(16)21)15(18)22/h6-7,9,12H,2-5,8H2,1H3,(H2,16,21)(H,17,20) |
| InChIKey | JUHHRWYEEBTUTI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|