C19H15ClN4O6 — CID 34351279
1-[2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide (PubChem CID 34351279) has the molecular formula C19H15ClN4O6 and a molecular weight of 430.80 g/mol. Its IUPAC name is 1-[2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 34351279 |
| Molecular Formula | C19H15ClN4O6 |
| Molecular Weight | 430.80 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 1-[2-[[5-(4-chlorophenyl)furan-2-yl]methylamino]-2-oxoethyl]-5-nitro-2-oxopyridine-3-carboxamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])cn(CC(=O)NCc2ccc(-c3ccc(Cl)cc3)o2)c1=O |
| InChI | InChI=1S/C19H15ClN4O6/c20-12-3-1-11(2-4-12)16-6-5-14(30-16)8-22-17(25)10-23-9-13(24(28)29)7-15(18(21)26)19(23)27/h1-7,9H,8,10H2,(H2,21,26)(H,22,25) |
| InChIKey | RQHMNVXOMHHQAK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 150.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.80 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|