C23H18ClF2N3O4 — CID 24520469
N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 24520469) has the molecular formula C23H18ClF2N3O4 and a molecular weight of 473.86 g/mol. Its IUPAC name is N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 24520469 |
| Molecular Formula | C23H18ClF2N3O4 |
| Molecular Weight | 473.86 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | N-[[5-(4-chlorophenyl)furan-2-yl]methyl]-2-[4-(3,4-difluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC1(c2ccc(F)c(F)c2)NC(=O)N(CC(=O)NCc2ccc(-c3ccc(Cl)cc3)o2)C1=O |
| InChI | InChI=1S/C23H18ClF2N3O4/c1-23(14-4-8-17(25)18(26)10-14)21(31)29(22(32)28-23)12-20(30)27-11-16-7-9-19(33-16)13-2-5-15(24)6-3-13/h2-10H,11-12H2,1H3,(H,27,30)(H,28,32) |
| InChIKey | URZRZCAXIMQIST-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|