C15H13Cl2N3O6 — CID 42942061
1-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-5-nitro-2-oxopyridine-3-carboxamide (PubChem CID 42942061) has the molecular formula C15H13Cl2N3O6 and a molecular weight of 402.19 g/mol. Its IUPAC name is 1-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-5-nitro-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-5-nitro-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 42942061 |
| Molecular Formula | C15H13Cl2N3O6 |
| Molecular Weight | 402.19 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | 1-[3-(2,4-dichlorophenoxy)-2-hydroxypropyl]-5-nitro-2-oxopyridine-3-carboxamide |
| SMILES | NC(=O)c1cc([N+](=O)[O-])cn(CC(O)COc2ccc(Cl)cc2Cl)c1=O |
| InChI | InChI=1S/C15H13Cl2N3O6/c16-8-1-2-13(12(17)3-8)26-7-10(21)6-19-5-9(20(24)25)4-11(14(18)22)15(19)23/h1-5,10,21H,6-7H2,(H2,18,22) |
| InChIKey | SORHUGMJMTTYIG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 137.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|