C21H21Cl2N3O2 — CID 8862868
4,5-dichloro-2-[2-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-2-oxoethyl]pyridazin-3-one (PubChem CID 8862868) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is 4,5-dichloro-2-[2-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-2-oxoethyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[2-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-2-oxoethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 8862868 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 4,5-dichloro-2-[2-[2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrol-3-yl]-2-oxoethyl]pyridazin-3-one |
| SMILES | Cc1cc(C(=O)Cn2ncc(Cl)c(Cl)c2=O)c(C)n1-c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C21H21Cl2N3O2/c1-12(2)15-5-7-16(8-6-15)26-13(3)9-17(14(26)4)19(27)11-25-21(28)20(23)18(22)10-24-25/h5-10,12H,11H2,1-4H3 |
| InChIKey | DNYQASVYRAMFQQ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|