C11H6N2O5S2 — CID 1349962
(5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 1349962) has the molecular formula C11H6N2O5S2 and a molecular weight of 310.31 g/mol. Its IUPAC name is (5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1349962 |
| Molecular Formula | C11H6N2O5S2 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | (5Z)-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1NC(=S)S/C1=C\c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C11H6N2O5S2/c14-10-9(20-11(19)12-10)2-5-1-7-8(18-4-17-7)3-6(5)13(15)16/h1-3H,4H2,(H,12,14,19)/b9-2- |
| InChIKey | UEWFSZGHGXQRQB-MBXJOHMKSA-N |
| XLogP | 1.81 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|