C13H11N3O5S — CID 1239094
3-methyl-2-methylimino-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 1239094) has the molecular formula C13H11N3O5S and a molecular weight of 321.31 g/mol. Its IUPAC name is 3-methyl-2-methylimino-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-methyl-2-methylimino-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1239094 |
| Molecular Formula | C13H11N3O5S |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 3-methyl-2-methylimino-5-[(6-nitro-1,3-benzodioxol-5-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | C/N=C1/SC(=Cc2cc3c(cc2[N+](=O)[O-])OCO3)C(=O)N1C |
| InChI | InChI=1S/C13H11N3O5S/c1-14-13-15(2)12(17)11(22-13)4-7-3-9-10(21-6-20-9)5-8(7)16(18)19/h3-5H,6H2,1-2H3/b11-4?,14-13+ |
| InChIKey | VISXSUREQUFGII-CYILSXDKSA-N |
| XLogP | 1.86 |
| TPSA | 94.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|