C21H25N5O7 — CID 56694198
5-[(2,4-dimorpholin-4-yl-5-nitrophenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 56694198) has the molecular formula C21H25N5O7 and a molecular weight of 459.46 g/mol. Its IUPAC name is 5-[(2,4-dimorpholin-4-yl-5-nitrophenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2,4-dimorpholin-4-yl-5-nitrophenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 56694198 |
| Molecular Formula | C21H25N5O7 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 5-[(2,4-dimorpholin-4-yl-5-nitrophenyl)methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=Cc2cc([N+](=O)[O-])c(N3CCOCC3)cc2N2CCOCC2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C21H25N5O7/c1-22-19(27)15(20(28)23(2)21(22)29)11-14-12-18(26(30)31)17(25-5-9-33-10-6-25)13-16(14)24-3-7-32-8-4-24/h11-13H,3-10H2,1-2H3 |
| InChIKey | VBADTHABOYVAOT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 125.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|