C26H27N5O5S — CID 6737878
2-[(2,4-dimorpholin-4-yl-5-nitrophenyl)methylidene]-5,6-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 6737878) has the molecular formula C26H27N5O5S and a molecular weight of 521.60 g/mol. Its IUPAC name is 2-[(2,4-dimorpholin-4-yl-5-nitrophenyl)methylidene]-5,6-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | 2-[(2,4-dimorpholin-4-yl-5-nitrophenyl)methylidene]-5,6-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 6737878 |
| Molecular Formula | C26H27N5O5S |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 2-[(2,4-dimorpholin-4-yl-5-nitrophenyl)methylidene]-5,6-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | Cc1ccc2c(nc3sc(=Cc4cc([N+](=O)[O-])c(N5CCOCC5)cc4N4CCOCC4)c(=O)n32)c1C |
| InChI | InChI=1S/C26H27N5O5S/c1-16-3-4-19-24(17(16)2)27-26-30(19)25(32)23(37-26)14-18-13-22(31(33)34)21(29-7-11-36-12-8-29)15-20(18)28-5-9-35-10-6-28/h3-4,13-15H,5-12H2,1-2H3 |
| InChIKey | QBXGWRFOIURBCF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|