C18H11Cl2N3O3S — CID 4571602
2-[(2,4-dichloro-5-nitrophenyl)methylidene]-5,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 4571602) has the molecular formula C18H11Cl2N3O3S and a molecular weight of 420.28 g/mol. Its IUPAC name is 2-[(2,4-dichloro-5-nitrophenyl)methylidene]-5,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | 2-[(2,4-dichloro-5-nitrophenyl)methylidene]-5,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 4571602 |
| Molecular Formula | C18H11Cl2N3O3S |
| Molecular Weight | 420.28 g/mol |
| Exact Mass | 418.99 |
| IUPAC Name | 2-[(2,4-dichloro-5-nitrophenyl)methylidene]-5,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | Cc1cc(C)c2nc3sc(=Cc4cc([N+](=O)[O-])c(Cl)cc4Cl)c(=O)n3c2c1 |
| InChI | InChI=1S/C18H11Cl2N3O3S/c1-8-3-9(2)16-14(4-8)22-17(24)15(27-18(22)21-16)6-10-5-13(23(25)26)12(20)7-11(10)19/h3-7H,1-2H3 |
| InChIKey | LVAJQMSDRNCPHX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.28 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|