C18H12ClN3O4S — CID 126397406
(2Z)-2-[(5-chloro-2-hydroxy-3-nitrophenyl)methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 126397406) has the molecular formula C18H12ClN3O4S and a molecular weight of 401.83 g/mol. Its IUPAC name is (2Z)-2-[(5-chloro-2-hydroxy-3-nitrophenyl)methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
| Compound Name | (2Z)-2-[(5-chloro-2-hydroxy-3-nitrophenyl)methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
|---|---|
| PubChem CID | 126397406 |
| Molecular Formula | C18H12ClN3O4S |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | (2Z)-2-[(5-chloro-2-hydroxy-3-nitrophenyl)methylidene]-6,7-dimethyl-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | Cc1cc2nc3s/c(=C\c4cc(Cl)cc([N+](=O)[O-])c4O)c(=O)n3c2cc1C |
| InChI | InChI=1S/C18H12ClN3O4S/c1-8-3-12-13(4-9(8)2)21-17(24)15(27-18(21)20-12)6-10-5-11(19)7-14(16(10)23)22(25)26/h3-7,23H,1-2H3/b15-6- |
| InChIKey | OBLQUFFGZHUWGH-UUASQNMZSA-N |
| XLogP | 3.34 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|