C23H29N5O5 — CID 4642858
1,3-dimethyl-5-[[5-nitro-2,4-di(piperidin-1-yl)phenyl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 4642858) has the molecular formula C23H29N5O5 and a molecular weight of 455.52 g/mol. Its IUPAC name is 1,3-dimethyl-5-[[5-nitro-2,4-di(piperidin-1-yl)phenyl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dimethyl-5-[[5-nitro-2,4-di(piperidin-1-yl)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 4642858 |
| Molecular Formula | C23H29N5O5 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 1,3-dimethyl-5-[[5-nitro-2,4-di(piperidin-1-yl)phenyl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(=Cc2cc([N+](=O)[O-])c(N3CCCCC3)cc2N2CCCCC2)C(=O)N(C)C1=O |
| InChI | InChI=1S/C23H29N5O5/c1-24-21(29)17(22(30)25(2)23(24)31)13-16-14-20(28(32)33)19(27-11-7-4-8-12-27)15-18(16)26-9-5-3-6-10-26/h13-15H,3-12H2,1-2H3 |
| InChIKey | BZTVQTUKIKNMBP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 107.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|